C24H24O9 — CID 23349622
dimethyl 2-[(1,4,5-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]butanedioate (PubChem CID 23349622) has the molecular formula C24H24O9 and a molecular weight of 456.45 g/mol. Its IUPAC name is dimethyl 2-[(1,4,5-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]butanedioate.
| Compound Name | dimethyl 2-[(1,4,5-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]butanedioate |
|---|---|
| PubChem CID | 23349622 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | dimethyl 2-[(1,4,5-trimethoxy-9,10-dioxoanthracen-2-yl)methyl]butanedioate |
| SMILES | COC(=O)CC(Cc1cc(OC)c2c(c1OC)C(=O)c1cccc(OC)c1C2=O)C(=O)OC |
| InChI | InChI=1S/C24H24O9/c1-29-15-8-6-7-14-18(15)22(27)19-16(30-2)10-12(23(32-4)20(19)21(14)26)9-13(24(28)33-5)11-17(25)31-3/h6-8,10,13H,9,11H2,1-5H3 |
| InChIKey | ZDBXIBDPZJVYHX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|