C24H22O10 — CID 54704740
dimethyl 3-hydroxy-4-[(1-hydroxy-4,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]pent-2-enedioate (PubChem CID 54704740) has the molecular formula C24H22O10 and a molecular weight of 470.43 g/mol. Its IUPAC name is dimethyl 3-hydroxy-4-[(1-hydroxy-4,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]pent-2-enedioate.
| Compound Name | dimethyl 3-hydroxy-4-[(1-hydroxy-4,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]pent-2-enedioate |
|---|---|
| PubChem CID | 54704740 |
| Molecular Formula | C24H22O10 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | dimethyl 3-hydroxy-4-[(1-hydroxy-4,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl]pent-2-enedioate |
| SMILES | COC(=O)C=C(O)C(Cc1cc(OC)c2c(c1O)C(=O)c1c(OC)cccc1C2=O)C(=O)OC |
| InChI | InChI=1S/C24H22O10/c1-31-15-7-5-6-12-18(15)23(29)20-19(22(12)28)16(32-2)9-11(21(20)27)8-13(24(30)34-4)14(25)10-17(26)33-3/h5-7,9-10,13,25,27H,8H2,1-4H3 |
| InChIKey | XSSKVTKUWCPRHK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|