C19H13F3O6 — CID 624473
(1,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl 2,2,2-trifluoroacetate (PubChem CID 624473) has the molecular formula C19H13F3O6 and a molecular weight of 394.30 g/mol. Its IUPAC name is (1,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl 2,2,2-trifluoroacetate.
| Compound Name | (1,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 624473 |
| Molecular Formula | C19H13F3O6 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (1,8-dimethoxy-9,10-dioxoanthracen-2-yl)methyl 2,2,2-trifluoroacetate |
| SMILES | COc1cccc2c1C(=O)c1c(ccc(COC(=O)C(F)(F)F)c1OC)C2=O |
| InChI | InChI=1S/C19H13F3O6/c1-26-12-5-3-4-10-13(12)16(24)14-11(15(10)23)7-6-9(17(14)27-2)8-28-18(25)19(20,21)22/h3-7H,8H2,1-2H3 |
| InChIKey | XLKXEBHERALPHB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|