C23H22O7 — CID 95931140
ethyl 5-(4,8-dimethoxy-9,10-dioxoanthracen-2-yl)-3-oxopentanoate (PubChem CID 95931140) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is ethyl 5-(4,8-dimethoxy-9,10-dioxoanthracen-2-yl)-3-oxopentanoate.
| Compound Name | ethyl 5-(4,8-dimethoxy-9,10-dioxoanthracen-2-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 95931140 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | ethyl 5-(4,8-dimethoxy-9,10-dioxoanthracen-2-yl)-3-oxopentanoate |
| SMILES | CCOC(=O)CC(=O)CCc1cc(OC)c2c(c1)C(=O)c1c(OC)cccc1C2=O |
| InChI | InChI=1S/C23H22O7/c1-4-30-19(25)12-14(24)9-8-13-10-16-21(18(11-13)29-3)22(26)15-6-5-7-17(28-2)20(15)23(16)27/h5-7,10-11H,4,8-9,12H2,1-3H3 |
| InChIKey | NSGFMZODDACTEL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|