C20H17NO6 — CID 135528716
[(E)-1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butylideneamino] acetate (PubChem CID 135528716) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is [(E)-1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butylideneamino] acetate.
| Compound Name | [(E)-1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butylideneamino] acetate |
|---|---|
| PubChem CID | 135528716 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(E)-1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)butylideneamino] acetate |
| SMILES | CCC/C(=N\OC(C)=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H17NO6/c1-3-6-14(21-27-10(2)22)13-9-15(23)16-17(20(13)26)19(25)12-8-5-4-7-11(12)18(16)24/h4-5,7-9,23,26H,3,6H2,1-2H3/b21-14+ |
| InChIKey | OAJRBTOPIKMXIT-KGENOOAVSA-N |
| XLogP | 2.94 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|