C29H27NO7 — CID 142627049
1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)hexyl 2-(4-formamidophenyl)acetate (PubChem CID 142627049) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)hexyl 2-(4-formamidophenyl)acetate.
| Compound Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)hexyl 2-(4-formamidophenyl)acetate |
|---|---|
| PubChem CID | 142627049 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 1-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)hexyl 2-(4-formamidophenyl)acetate |
| SMILES | CCCCCC(OC(=O)Cc1ccc(NC=O)cc1)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H27NO7/c1-2-3-4-9-23(37-24(33)14-17-10-12-18(13-11-17)30-16-31)21-15-22(32)25-26(29(21)36)28(35)20-8-6-5-7-19(20)27(25)34/h5-8,10-13,15-16,23,32,36H,2-4,9,14H2,1H3,(H,30,31) |
| InChIKey | DMJIGCWERAKMQN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|