C33H32O8 — CID 102073667
tert-butyl [2-[(3-ethenylphenyl)methyl]-4-[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-1-yl] carbonate (PubChem CID 102073667) has the molecular formula C33H32O8 and a molecular weight of 556.61 g/mol. Its IUPAC name is tert-butyl [2-[(3-ethenylphenyl)methyl]-4-[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-1-yl] carbonate.
| Compound Name | tert-butyl [2-[(3-ethenylphenyl)methyl]-4-[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-1-yl] carbonate |
|---|---|
| PubChem CID | 102073667 |
| Molecular Formula | C33H32O8 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | tert-butyl [2-[(3-ethenylphenyl)methyl]-4-[(2-methylpropan-2-yl)oxycarbonyloxy]-9,10-dioxoanthracen-1-yl] carbonate |
| SMILES | C=Cc1cccc(Cc2cc(OC(=O)OC(C)(C)C)c3c(c2OC(=O)OC(C)(C)C)C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C33H32O8/c1-8-19-12-11-13-20(16-19)17-21-18-24(38-30(36)40-32(2,3)4)25-26(29(21)39-31(37)41-33(5,6)7)28(35)23-15-10-9-14-22(23)27(25)34/h8-16,18H,1,17H2,2-7H3 |
| InChIKey | POZPEKBXYYVDSB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|