C32H40O10S — CID 90784075
[2-benzyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl] tert-butyl carbonate;formaldehyde;methyl benzenesulfonate (PubChem CID 90784075) has the molecular formula C32H40O10S and a molecular weight of 616.73 g/mol. Its IUPAC name is [2-benzyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl] tert-butyl carbonate;formaldehyde;methyl benzenesulfonate.
| Compound Name | [2-benzyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl] tert-butyl carbonate;formaldehyde;methyl benzenesulfonate |
|---|---|
| PubChem CID | 90784075 |
| Molecular Formula | C32H40O10S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [2-benzyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl] tert-butyl carbonate;formaldehyde;methyl benzenesulfonate |
| SMILES | C=O.COS(=O)(=O)c1ccccc1.Cc1cc(OC(=O)OC(C)(C)C)c(Cc2ccccc2)cc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30O6.C7H8O3S.CH2O/c1-16-13-20(28-22(26)30-24(5,6)7)18(14-17-11-9-8-10-12-17)15-19(16)27-21(25)29-23(2,3)4;1-10-11(8,9)7-5-3-2-4-6-7;1-2/h8-13,15H,14H2,1-7H3;2-6H,1H3;1H2 |
| InChIKey | DRKGHBJVALKDMP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|