About (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate
(2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate (PubChem CID 126660621) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate.
Molecular Properties
| Compound Name | (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate |
| PubChem CID | 126660621 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate |
| SMILES | C=CCc1cccc(OC(=O)OC(C)(C)C)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O4/c1-5-10-15-13-9-14-17(24-20(23)25-21(2,3)4)18(15)19(22)16-11-7-6-8-12-16/h5-9,11-14H,1,10H2,2-4H3 |
| InChIKey | WUKLMBQYMYGINT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate?
The IUPAC name of (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate (CID 126660621) is (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate.
What is the SMILES notation for (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate?
The canonical SMILES for (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate is C=CCc1cccc(OC(=O)OC(C)(C)C)c1C(=O)c1ccccc1.
What is the InChIKey of (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate?
The InChIKey is WUKLMBQYMYGINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O4/c1-5-10-15-13-9-14-17(24-20(23)25-21(2,3)4)18(15)19(22)16-11-7-6-8-12-16/h5-9,11-14H,1,10H2,2-4H3.
What are the key properties of (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate?
(2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate has a molecular weight of 338.40 g/mol, XLogP of 4.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzoyl-3-prop-2-enylphenyl) tert-butyl carbonate is sourced from PubChem (CID 126660621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).