About (3-ethenylphenyl)methyl butanoate
(3-ethenylphenyl)methyl butanoate (PubChem CID 89419306) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (3-ethenylphenyl)methyl butanoate.
Molecular Properties
| Compound Name | (3-ethenylphenyl)methyl butanoate |
| PubChem CID | 89419306 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3-ethenylphenyl)methyl butanoate |
| SMILES | C=Cc1cccc(COC(=O)CCC)c1 |
| InChI | InChI=1S/C13H16O2/c1-3-6-13(14)15-10-12-8-5-7-11(4-2)9-12/h4-5,7-9H,2-3,6,10H2,1H3 |
| InChIKey | SBIANNCVYYZHPT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-ethenylphenyl)methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethenylphenyl)methyl butanoate?
The IUPAC name of (3-ethenylphenyl)methyl butanoate (CID 89419306) is (3-ethenylphenyl)methyl butanoate.
What is the SMILES notation for (3-ethenylphenyl)methyl butanoate?
The canonical SMILES for (3-ethenylphenyl)methyl butanoate is C=Cc1cccc(COC(=O)CCC)c1.
What is the InChIKey of (3-ethenylphenyl)methyl butanoate?
The InChIKey is SBIANNCVYYZHPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-3-6-13(14)15-10-12-8-5-7-11(4-2)9-12/h4-5,7-9H,2-3,6,10H2,1H3.
What are the key properties of (3-ethenylphenyl)methyl butanoate?
(3-ethenylphenyl)methyl butanoate has a molecular weight of 204.27 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethenylphenyl)methyl butanoate is sourced from PubChem (CID 89419306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).