About O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate
O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate (PubChem CID 176729408) has the molecular formula C14H12OS2
and a molecular weight of 260.38 g/mol. Its IUPAC name is O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate.
Molecular Properties
| Compound Name | O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate |
| PubChem CID | 176729408 |
| Molecular Formula | C14H12OS2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate |
| SMILES | C=Cc1cccc(COC(=S)c2cccs2)c1 |
| InChI | InChI=1S/C14H12OS2/c1-2-11-5-3-6-12(9-11)10-15-14(16)13-7-4-8-17-13/h2-9H,1,10H2 |
| InChIKey | ZODQWNWUYKMLFL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate?
The IUPAC name of O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate (CID 176729408) is O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate.
What is the SMILES notation for O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate?
The canonical SMILES for O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate is C=Cc1cccc(COC(=S)c2cccs2)c1.
What is the InChIKey of O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate?
The InChIKey is ZODQWNWUYKMLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS2/c1-2-11-5-3-6-12(9-11)10-15-14(16)13-7-4-8-17-13/h2-9H,1,10H2.
What are the key properties of O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate?
O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate has a molecular weight of 260.38 g/mol, XLogP of 4.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(3-ethenylphenyl)methyl] thiophene-2-carbothioate is sourced from PubChem (CID 176729408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).