About (3-aminophenyl)methyl thiophene-2-carboxylate
(3-aminophenyl)methyl thiophene-2-carboxylate (PubChem CID 175305802) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is (3-aminophenyl)methyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (3-aminophenyl)methyl thiophene-2-carboxylate |
| PubChem CID | 175305802 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | (3-aminophenyl)methyl thiophene-2-carboxylate |
| SMILES | Nc1cccc(COC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C12H11NO2S/c13-10-4-1-3-9(7-10)8-15-12(14)11-5-2-6-16-11/h1-7H,8,13H2 |
| InChIKey | XHZZFPBLPOPONQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-aminophenyl)methyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminophenyl)methyl thiophene-2-carboxylate?
The IUPAC name of (3-aminophenyl)methyl thiophene-2-carboxylate (CID 175305802) is (3-aminophenyl)methyl thiophene-2-carboxylate.
What is the SMILES notation for (3-aminophenyl)methyl thiophene-2-carboxylate?
The canonical SMILES for (3-aminophenyl)methyl thiophene-2-carboxylate is Nc1cccc(COC(=O)c2cccs2)c1.
What is the InChIKey of (3-aminophenyl)methyl thiophene-2-carboxylate?
The InChIKey is XHZZFPBLPOPONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c13-10-4-1-3-9(7-10)8-15-12(14)11-5-2-6-16-11/h1-7H,8,13H2.
What are the key properties of (3-aminophenyl)methyl thiophene-2-carboxylate?
(3-aminophenyl)methyl thiophene-2-carboxylate has a molecular weight of 233.29 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminophenyl)methyl thiophene-2-carboxylate is sourced from PubChem (CID 175305802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).