C33H26F6O6 — CID 159639442
(3-ethenylphenyl)methyl prop-2-enoate;[2-[1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate (PubChem CID 159639442) has the molecular formula C33H26F6O6 and a molecular weight of 632.55 g/mol. Its IUPAC name is (3-ethenylphenyl)methyl prop-2-enoate;[2-[1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate.
| Compound Name | (3-ethenylphenyl)methyl prop-2-enoate;[2-[1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 159639442 |
| Molecular Formula | C33H26F6O6 |
| Molecular Weight | 632.55 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | (3-ethenylphenyl)methyl prop-2-enoate;[2-[1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoyloxyphenyl)propan-2-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)OCc1cccc(C=C)c1.C=CC(=O)Oc1ccccc1C(c1ccccc1OC(=O)C=C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H14F6O4.C12H12O2/c1-3-17(28)30-15-11-7-5-9-13(15)19(20(22,23)24,21(25,26)27)14-10-6-8-12-16(14)31-18(29)4-2;1-3-10-6-5-7-11(8-10)9-14-12(13)4-2/h3-12H,1-2H2;3-8H,1-2,9H2 |
| InChIKey | MQDWDPYMWOIUHC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.55 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|