C23H18O7 — CID 118069099
[4-[2,5-di(prop-2-enoyloxy)benzoyl]phenyl]methyl prop-2-enoate (PubChem CID 118069099) has the molecular formula C23H18O7 and a molecular weight of 406.39 g/mol. Its IUPAC name is [4-[2,5-di(prop-2-enoyloxy)benzoyl]phenyl]methyl prop-2-enoate.
| Compound Name | [4-[2,5-di(prop-2-enoyloxy)benzoyl]phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 118069099 |
| Molecular Formula | C23H18O7 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [4-[2,5-di(prop-2-enoyloxy)benzoyl]phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1ccc(C(=O)c2cc(OC(=O)C=C)ccc2OC(=O)C=C)cc1 |
| InChI | InChI=1S/C23H18O7/c1-4-20(24)28-14-15-7-9-16(10-8-15)23(27)18-13-17(29-21(25)5-2)11-12-19(18)30-22(26)6-3/h4-13H,1-3,14H2 |
| InChIKey | VDGAENUZZGFTCT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|