About O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride
O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride (PubChem CID 158366596) has the molecular formula C7H10ClNOS2
and a molecular weight of 223.75 g/mol. Its IUPAC name is O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride.
Molecular Properties
| Compound Name | O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride |
| PubChem CID | 158366596 |
| Molecular Formula | C7H10ClNOS2 |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride |
| SMILES | Cl.NCCOC(=S)c1cccs1 |
| InChI | InChI=1S/C7H9NOS2.ClH/c8-3-4-9-7(10)6-2-1-5-11-6;/h1-2,5H,3-4,8H2;1H |
| InChIKey | GUCJNQQVGFVQJB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride?
The IUPAC name of O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride (CID 158366596) is O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride.
What is the SMILES notation for O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride?
The canonical SMILES for O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride is Cl.NCCOC(=S)c1cccs1.
What is the InChIKey of O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride?
The InChIKey is GUCJNQQVGFVQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS2.ClH/c8-3-4-9-7(10)6-2-1-5-11-6;/h1-2,5H,3-4,8H2;1H.
What are the key properties of O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride?
O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride has a molecular weight of 223.75 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-aminoethyl) thiophene-2-carbothioate;hydrochloride is sourced from PubChem (CID 158366596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).