About (3-formylphenyl)methyl propanoate
(3-formylphenyl)methyl propanoate (PubChem CID 121217637) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is (3-formylphenyl)methyl propanoate.
Molecular Properties
| Compound Name | (3-formylphenyl)methyl propanoate |
| PubChem CID | 121217637 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3-formylphenyl)methyl propanoate |
| SMILES | CCC(=O)OCc1cccc(C=O)c1 |
| InChI | InChI=1S/C11H12O3/c1-2-11(13)14-8-10-5-3-4-9(6-10)7-12/h3-7H,2,8H2,1H3 |
| InChIKey | VAJCTBKTRURAQW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-formylphenyl)methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-formylphenyl)methyl propanoate?
The IUPAC name of (3-formylphenyl)methyl propanoate (CID 121217637) is (3-formylphenyl)methyl propanoate.
What is the SMILES notation for (3-formylphenyl)methyl propanoate?
The canonical SMILES for (3-formylphenyl)methyl propanoate is CCC(=O)OCc1cccc(C=O)c1.
What is the InChIKey of (3-formylphenyl)methyl propanoate?
The InChIKey is VAJCTBKTRURAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c1-2-11(13)14-8-10-5-3-4-9(6-10)7-12/h3-7H,2,8H2,1H3.
What are the key properties of (3-formylphenyl)methyl propanoate?
(3-formylphenyl)methyl propanoate has a molecular weight of 192.21 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-formylphenyl)methyl propanoate is sourced from PubChem (CID 121217637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).