C28H21ClN2O — CID 142244892
4-(4-chloroanilino)-1-(4-methylanilino)-10-methylideneanthracen-9-one (PubChem CID 142244892) has the molecular formula C28H21ClN2O and a molecular weight of 436.94 g/mol. Its IUPAC name is 4-(4-chloroanilino)-1-(4-methylanilino)-10-methylideneanthracen-9-one.
| Compound Name | 4-(4-chloroanilino)-1-(4-methylanilino)-10-methylideneanthracen-9-one |
|---|---|
| PubChem CID | 142244892 |
| Molecular Formula | C28H21ClN2O |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-(4-chloroanilino)-1-(4-methylanilino)-10-methylideneanthracen-9-one |
| SMILES | C=C1c2ccccc2C(=O)c2c(Nc3ccc(C)cc3)ccc(Nc3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C28H21ClN2O/c1-17-7-11-20(12-8-17)31-25-16-15-24(30-21-13-9-19(29)10-14-21)26-18(2)22-5-3-4-6-23(22)28(32)27(25)26/h3-16,30-31H,2H2,1H3 |
| InChIKey | MKPHXJLBUWNNFJ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|