C30H22N2O2 — CID 15279527
10-(4-methylanilino)-14-(4-methylphenyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 15279527) has the molecular formula C30H22N2O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 10-(4-methylanilino)-14-(4-methylphenyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10-(4-methylanilino)-14-(4-methylphenyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 15279527 |
| Molecular Formula | C30H22N2O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 10-(4-methylanilino)-14-(4-methylphenyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | Cc1ccc(Nc2ccc3c4c(cc(=O)n3-c3ccc(C)cc3)-c3ccccc3C(=O)c24)cc1 |
| InChI | InChI=1S/C30H22N2O2/c1-18-7-11-20(12-8-18)31-25-15-16-26-28-24(22-5-3-4-6-23(22)30(34)29(25)28)17-27(33)32(26)21-13-9-19(2)10-14-21/h3-17,31H,1-2H3 |
| InChIKey | UHDOUKBQABMESU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|