C23H13ClLi2N2O8S2 — CID 22897963
dilithium;4-chloro-6-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzene-1,3-disulfonate (PubChem CID 22897963) has the molecular formula C23H13ClLi2N2O8S2 and a molecular weight of 558.83 g/mol. Its IUPAC name is dilithium;4-chloro-6-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzene-1,3-disulfonate.
| Compound Name | dilithium;4-chloro-6-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 22897963 |
| Molecular Formula | C23H13ClLi2N2O8S2 |
| Molecular Weight | 558.83 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | dilithium;4-chloro-6-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzene-1,3-disulfonate |
| SMILES | Cn1c(=O)cc2c3c(c(Nc4cc(Cl)c(S(=O)(=O)[O-])cc4S(=O)(=O)[O-])ccc31)C(=O)c1ccccc1-2.[Li+].[Li+] |
| InChI | InChI=1S/C23H15ClN2O8S2.2Li/c1-26-17-7-6-15(25-16-9-14(24)18(35(29,30)31)10-19(16)36(32,33)34)22-21(17)13(8-20(26)27)11-4-2-3-5-12(11)23(22)28;;/h2-10,25H,1H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2 |
| InChIKey | WJDUCEAUNJWJGF-UHFFFAOYSA-L |
| XLogP | -3.04 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.83 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|