C23H25N3O2 — CID 123987145
10-(6-aminohexylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 123987145) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 10-(6-aminohexylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10-(6-aminohexylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 123987145 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 10-(6-aminohexylamino)-14-methyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | Cn1c(=O)cc2c3c(c(NCCCCCCN)ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H25N3O2/c1-26-19-11-10-18(25-13-7-3-2-6-12-24)22-21(19)17(14-20(26)27)15-8-4-5-9-16(15)23(22)28/h4-5,8-11,14,25H,2-3,6-7,12-13,24H2,1H3 |
| InChIKey | ADGRGPDRPTUZOK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|