C24H19N3O5S — CID 90316929
2-[amino-(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-5-methylbenzenesulfonic acid (PubChem CID 90316929) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[amino-(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[amino-(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90316929 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[amino-(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-5-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(N(N)c2ccc3c4c(cc(=O)n3C)-c3ccccc3C(=O)c24)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H19N3O5S/c1-13-7-8-17(20(11-13)33(30,31)32)27(25)19-10-9-18-22-16(12-21(28)26(18)2)14-5-3-4-6-15(14)24(29)23(19)22/h3-12H,25H2,1-2H3,(H,30,31,32) |
| InChIKey | JDPKLOULOGZKRH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|