C23H14N2O8S2-2 — CID 58814461
4-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-3-oxidoperoxysulfanylbenzenesulfonate (PubChem CID 58814461) has the molecular formula C23H14N2O8S2-2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 4-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-3-oxidoperoxysulfanylbenzenesulfonate.
| Compound Name | 4-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-3-oxidoperoxysulfanylbenzenesulfonate |
|---|---|
| PubChem CID | 58814461 |
| Molecular Formula | C23H14N2O8S2-2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 4-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-3-oxidoperoxysulfanylbenzenesulfonate |
| SMILES | Cn1c(=O)cc2c3c(c(Nc4ccc(S(=O)(=O)[O-])cc4SOO[O-])ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H16N2O8S2/c1-25-18-9-8-17(24-16-7-6-12(35(29,30)31)10-19(16)34-33-32-28)22-21(18)15(11-20(25)26)13-4-2-3-5-14(13)23(22)27/h2-11,24,28H,1H3,(H,29,30,31)/p-2 |
| InChIKey | FATJJWBXIXMOFN-UHFFFAOYSA-L |
| XLogP | 2.63 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|