C28H20N2Na2O8S2 — CID 20813002
disodium;5-methyl-2-[[5-(4-methyl-2-oxidoperoxysulfanylanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate (PubChem CID 20813002) has the molecular formula C28H20N2Na2O8S2 and a molecular weight of 622.59 g/mol. Its IUPAC name is disodium;5-methyl-2-[[5-(4-methyl-2-oxidoperoxysulfanylanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate.
| Compound Name | disodium;5-methyl-2-[[5-(4-methyl-2-oxidoperoxysulfanylanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 20813002 |
| Molecular Formula | C28H20N2Na2O8S2 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | disodium;5-methyl-2-[[5-(4-methyl-2-oxidoperoxysulfanylanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate |
| SMILES | Cc1ccc(Nc2cccc3c2C(=O)c2cccc(Nc4ccc(C)cc4S(=O)(=O)[O-])c2C3=O)c(SOO[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C28H22N2O8S2.2Na/c1-15-9-11-19(23(13-15)39-38-37-33)29-21-7-3-5-17-25(21)27(31)18-6-4-8-22(26(18)28(17)32)30-20-12-10-16(2)14-24(20)40(34,35)36;;/h3-14,29-30,33H,1-2H3,(H,34,35,36);;/q;2*+1/p-2 |
| InChIKey | HLJBCJWZHQXCMH-UHFFFAOYSA-L |
| XLogP | -1.29 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|