C23H18N2O5S — CID 159706435
9,10-dioxoanthracene-1-diazonium;1,3,5-trimethyl-2-oxidoperoxysulfanylbenzene (PubChem CID 159706435) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is 9,10-dioxoanthracene-1-diazonium;1,3,5-trimethyl-2-oxidoperoxysulfanylbenzene.
| Compound Name | 9,10-dioxoanthracene-1-diazonium;1,3,5-trimethyl-2-oxidoperoxysulfanylbenzene |
|---|---|
| PubChem CID | 159706435 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 9,10-dioxoanthracene-1-diazonium;1,3,5-trimethyl-2-oxidoperoxysulfanylbenzene |
| SMILES | Cc1cc(C)c(SOO[O-])c(C)c1.N#[N+]c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H7N2O2.C9H12O3S/c15-16-11-7-3-6-10-12(11)14(18)9-5-2-1-4-8(9)13(10)17;1-6-4-7(2)9(8(3)5-6)13-12-11-10/h1-7H;4-5,10H,1-3H3/q+1;/p-1 |
| InChIKey | MYGSXDWSVSEPPO-UHFFFAOYSA-M |
| XLogP | 4.79 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|