C21H13ClO3 — CID 134117733
1-(2-chloro-4-methylphenoxy)anthracene-9,10-dione (PubChem CID 134117733) has the molecular formula C21H13ClO3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenoxy)anthracene-9,10-dione.
| Compound Name | 1-(2-chloro-4-methylphenoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 134117733 |
| Molecular Formula | C21H13ClO3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 1-(2-chloro-4-methylphenoxy)anthracene-9,10-dione |
| SMILES | Cc1ccc(Oc2cccc3c2C(=O)c2ccccc2C3=O)c(Cl)c1 |
| InChI | InChI=1S/C21H13ClO3/c1-12-9-10-17(16(22)11-12)25-18-8-4-7-15-19(18)21(24)14-6-3-2-5-13(14)20(15)23/h2-11H,1H3 |
| InChIKey | CSRWVEABXQRUTP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|