C54H58O8P2 — CID 58931576
[8-bis(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-9,10-dioxoanthracen-1-yl] bis(5-methyl-2-propan-2-ylphenyl) phosphite (PubChem CID 58931576) has the molecular formula C54H58O8P2 and a molecular weight of 897.00 g/mol. Its IUPAC name is [8-bis(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-9,10-dioxoanthracen-1-yl] bis(5-methyl-2-propan-2-ylphenyl) phosphite.
| Compound Name | [8-bis(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-9,10-dioxoanthracen-1-yl] bis(5-methyl-2-propan-2-ylphenyl) phosphite |
|---|---|
| PubChem CID | 58931576 |
| Molecular Formula | C54H58O8P2 |
| Molecular Weight | 897.00 g/mol |
| Exact Mass | 896.36 |
| IUPAC Name | [8-bis(5-methyl-2-propan-2-ylphenoxy)phosphanyloxy-9,10-dioxoanthracen-1-yl] bis(5-methyl-2-propan-2-ylphenyl) phosphite |
| SMILES | Cc1ccc(C(C)C)c(OP(Oc2cc(C)ccc2C(C)C)Oc2cccc3c2C(=O)c2c(OP(Oc4cc(C)ccc4C(C)C)Oc4cc(C)ccc4C(C)C)cccc2C3=O)c1 |
| InChI | InChI=1S/C54H58O8P2/c1-31(2)39-23-19-35(9)27-47(39)59-63(60-48-28-36(10)20-24-40(48)32(3)4)57-45-17-13-15-43-51(45)54(56)52-44(53(43)55)16-14-18-46(52)58-64(61-49-29-37(11)21-25-41(49)33(5)6)62-50-30-38(12)22-26-42(50)34(7)8/h13-34H,1-12H3 |
| InChIKey | ISGJJOHRXHFIJR-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.00 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|