C12H15F3O3S — CID 75447874
(5-methyl-2-propan-2-ylphenyl) 2,2,2-trifluoroethanesulfonate (PubChem CID 75447874) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 2,2,2-trifluoroethanesulfonate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 75447874 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 2,2,2-trifluoroethanesulfonate |
| SMILES | Cc1ccc(C(C)C)c(OS(=O)(=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O3S/c1-8(2)10-5-4-9(3)6-11(10)18-19(16,17)7-12(13,14)15/h4-6,8H,7H2,1-3H3 |
| InChIKey | IQSLQTFGNVFAAN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|