C22H27Cl2FO2 — CID 155930094
2-[2,2-dichloro-1-fluoro-1-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-4-methyl-1-propan-2-ylbenzene (PubChem CID 155930094) has the molecular formula C22H27Cl2FO2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 2-[2,2-dichloro-1-fluoro-1-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-4-methyl-1-propan-2-ylbenzene.
| Compound Name | 2-[2,2-dichloro-1-fluoro-1-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-4-methyl-1-propan-2-ylbenzene |
|---|---|
| PubChem CID | 155930094 |
| Molecular Formula | C22H27Cl2FO2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[2,2-dichloro-1-fluoro-1-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-4-methyl-1-propan-2-ylbenzene |
| SMILES | Cc1ccc(C(C)C)c(OC(F)(Oc2cc(C)ccc2C(C)C)C(Cl)Cl)c1 |
| InChI | InChI=1S/C22H27Cl2FO2/c1-13(2)17-9-7-15(5)11-19(17)26-22(25,21(23)24)27-20-12-16(6)8-10-18(20)14(3)4/h7-14,21H,1-6H3 |
| InChIKey | VOAXQXZYBDFLTE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|