C17H17ClF2O — CID 63567841
5-(chloromethyl)-1,3-difluoro-2-(5-methyl-2-propan-2-ylphenoxy)benzene (PubChem CID 63567841) has the molecular formula C17H17ClF2O and a molecular weight of 310.77 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-difluoro-2-(5-methyl-2-propan-2-ylphenoxy)benzene.
| Compound Name | 5-(chloromethyl)-1,3-difluoro-2-(5-methyl-2-propan-2-ylphenoxy)benzene |
|---|---|
| PubChem CID | 63567841 |
| Molecular Formula | C17H17ClF2O |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-(chloromethyl)-1,3-difluoro-2-(5-methyl-2-propan-2-ylphenoxy)benzene |
| SMILES | Cc1ccc(C(C)C)c(Oc2c(F)cc(CCl)cc2F)c1 |
| InChI | InChI=1S/C17H17ClF2O/c1-10(2)13-5-4-11(3)6-16(13)21-17-14(19)7-12(9-18)8-15(17)20/h4-8,10H,9H2,1-3H3 |
| InChIKey | JMULXPTXGSIJAN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|