C17H19F2NO — CID 63817006
1-[4-(2,4-dimethylphenoxy)-3,5-difluorophenyl]propan-2-amine (PubChem CID 63817006) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenoxy)-3,5-difluorophenyl]propan-2-amine.
| Compound Name | 1-[4-(2,4-dimethylphenoxy)-3,5-difluorophenyl]propan-2-amine |
|---|---|
| PubChem CID | 63817006 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[4-(2,4-dimethylphenoxy)-3,5-difluorophenyl]propan-2-amine |
| SMILES | Cc1ccc(Oc2c(F)cc(CC(C)N)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H19F2NO/c1-10-4-5-16(11(2)6-10)21-17-14(18)8-13(7-12(3)20)9-15(17)19/h4-6,8-9,12H,7,20H2,1-3H3 |
| InChIKey | RLDMZBOURJPCTC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |