C11H15F2N — CID 117288723
1-[3-fluoro-4-(fluoromethyl)-5-methylphenyl]propan-2-amine (PubChem CID 117288723) has the molecular formula C11H15F2N and a molecular weight of 199.24 g/mol. Its IUPAC name is 1-[3-fluoro-4-(fluoromethyl)-5-methylphenyl]propan-2-amine.
| Compound Name | 1-[3-fluoro-4-(fluoromethyl)-5-methylphenyl]propan-2-amine |
|---|---|
| PubChem CID | 117288723 |
| Molecular Formula | C11H15F2N |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-[3-fluoro-4-(fluoromethyl)-5-methylphenyl]propan-2-amine |
| SMILES | Cc1cc(CC(C)N)cc(F)c1CF |
| InChI | InChI=1S/C11H15F2N/c1-7-3-9(4-8(2)14)5-11(13)10(7)6-12/h3,5,8H,4,6,14H2,1-2H3 |
| InChIKey | BOQPYHDPBBGMOQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |