About [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite
[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite (PubChem CID 142925487) has the molecular formula C39H42O6P2
and a molecular weight of 668.71 g/mol. Its IUPAC name is [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite.
Molecular Properties
| Compound Name | [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite |
| PubChem CID | 142925487 |
| Molecular Formula | C39H42O6P2 |
| Molecular Weight | 668.71 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite |
| SMILES | CC(C)c1ccccc1OP(O)Oc1ccccc1-c1ccccc1OP(Oc1ccccc1C(C)C)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C39H42O6P2/c1-27(2)30-17-7-12-22-35(30)41-46(40)42-38-25-15-10-20-33(38)34-21-11-16-26-39(34)45-47(43-36-23-13-8-18-31(36)28(3)4)44-37-24-14-9-19-32(37)29(5)6/h7-29,40H,1-6H3 |
| InChIKey | COEWTCWKWJYNJU-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.71 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite?
The IUPAC name of [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite (CID 142925487) is [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite.
What is the SMILES notation for [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite?
The canonical SMILES for [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite is CC(C)c1ccccc1OP(O)Oc1ccccc1-c1ccccc1OP(Oc1ccccc1C(C)C)Oc1ccccc1C(C)C.
What is the InChIKey of [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite?
The InChIKey is COEWTCWKWJYNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H42O6P2/c1-27(2)30-17-7-12-22-35(30)41-46(40)42-38-25-15-10-20-33(38)34-21-11-16-26-39(34)45-47(43-36-23-13-8-18-31(36)28(3)4)44-37-24-14-9-19-32(37)29(5)6/h7-29,40H,1-6H3.
What are the key properties of [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite?
[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite has a molecular weight of 668.71 g/mol, XLogP of 12.16, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite is sourced from PubChem (CID 142925487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).