About tris(2-butan-2-ylphenyl) phosphite
tris(2-butan-2-ylphenyl) phosphite (PubChem CID 18519322) has the molecular formula C30H39O3P
and a molecular weight of 478.61 g/mol. Its IUPAC name is tris(2-butan-2-ylphenyl) phosphite.
Molecular Properties
| Compound Name | tris(2-butan-2-ylphenyl) phosphite |
| PubChem CID | 18519322 |
| Molecular Formula | C30H39O3P |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tris(2-butan-2-ylphenyl) phosphite |
| SMILES | CCC(C)c1ccccc1OP(Oc1ccccc1C(C)CC)Oc1ccccc1C(C)CC |
| InChI | InChI=1S/C30H39O3P/c1-7-22(4)25-16-10-13-19-28(25)31-34(32-29-20-14-11-17-26(29)23(5)8-2)33-30-21-15-12-18-27(30)24(6)9-3/h10-24H,7-9H2,1-6H3 |
| InChIKey | DPXMCGQIIKXTKL-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(2-butan-2-ylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-butan-2-ylphenyl) phosphite?
The IUPAC name of tris(2-butan-2-ylphenyl) phosphite (CID 18519322) is tris(2-butan-2-ylphenyl) phosphite.
What is the SMILES notation for tris(2-butan-2-ylphenyl) phosphite?
The canonical SMILES for tris(2-butan-2-ylphenyl) phosphite is CCC(C)c1ccccc1OP(Oc1ccccc1C(C)CC)Oc1ccccc1C(C)CC.
What is the InChIKey of tris(2-butan-2-ylphenyl) phosphite?
The InChIKey is DPXMCGQIIKXTKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H39O3P/c1-7-22(4)25-16-10-13-19-28(25)31-34(32-29-20-14-11-17-26(29)23(5)8-2)33-30-21-15-12-18-27(30)24(6)9-3/h10-24H,7-9H2,1-6H3.
What are the key properties of tris(2-butan-2-ylphenyl) phosphite?
tris(2-butan-2-ylphenyl) phosphite has a molecular weight of 478.61 g/mol, XLogP of 9.99, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-butan-2-ylphenyl) phosphite is sourced from PubChem (CID 18519322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).