C44H60O7P2 — CID 59498746
2-[2-bis(2-butan-2-ylphenoxy)phosphanyloxyethoxy]ethyl bis(2-butan-2-ylphenyl) phosphite (PubChem CID 59498746) has the molecular formula C44H60O7P2 and a molecular weight of 762.91 g/mol. Its IUPAC name is 2-[2-bis(2-butan-2-ylphenoxy)phosphanyloxyethoxy]ethyl bis(2-butan-2-ylphenyl) phosphite.
| Compound Name | 2-[2-bis(2-butan-2-ylphenoxy)phosphanyloxyethoxy]ethyl bis(2-butan-2-ylphenyl) phosphite |
|---|---|
| PubChem CID | 59498746 |
| Molecular Formula | C44H60O7P2 |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.38 |
| IUPAC Name | 2-[2-bis(2-butan-2-ylphenoxy)phosphanyloxyethoxy]ethyl bis(2-butan-2-ylphenyl) phosphite |
| SMILES | CCC(C)c1ccccc1OP(OCCOCCOP(Oc1ccccc1C(C)CC)Oc1ccccc1C(C)CC)Oc1ccccc1C(C)CC |
| InChI | InChI=1S/C44H60O7P2/c1-9-33(5)37-21-13-17-25-41(37)48-52(49-42-26-18-14-22-38(42)34(6)10-2)46-31-29-45-30-32-47-53(50-43-27-19-15-23-39(43)35(7)11-3)51-44-28-20-16-24-40(44)36(8)12-4/h13-28,33-36H,9-12,29-32H2,1-8H3 |
| InChIKey | RAXWMJLUXKPNIC-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|