C24H27O3P — CID 141189598
[2,4-bis(2-propan-2-ylphenyl)phenyl] dihydrogen phosphite (PubChem CID 141189598) has the molecular formula C24H27O3P and a molecular weight of 394.45 g/mol. Its IUPAC name is [2,4-bis(2-propan-2-ylphenyl)phenyl] dihydrogen phosphite.
| Compound Name | [2,4-bis(2-propan-2-ylphenyl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 141189598 |
| Molecular Formula | C24H27O3P |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [2,4-bis(2-propan-2-ylphenyl)phenyl] dihydrogen phosphite |
| SMILES | CC(C)c1ccccc1-c1ccc(OP(O)O)c(-c2ccccc2C(C)C)c1 |
| InChI | InChI=1S/C24H27O3P/c1-16(2)19-9-5-7-11-21(19)18-13-14-24(27-28(25)26)23(15-18)22-12-8-6-10-20(22)17(3)4/h5-17,25-26H,1-4H3 |
| InChIKey | XDJPKKAIOXTRCD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|