C50H62O6P2 — CID 142925486
buta-1,3-diene;(E)-3,4-dimethylpent-2-ene;[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite (PubChem CID 142925486) has the molecular formula C50H62O6P2 and a molecular weight of 820.99 g/mol. Its IUPAC name is buta-1,3-diene;(E)-3,4-dimethylpent-2-ene;[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite.
| Compound Name | buta-1,3-diene;(E)-3,4-dimethylpent-2-ene;[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite |
|---|---|
| PubChem CID | 142925486 |
| Molecular Formula | C50H62O6P2 |
| Molecular Weight | 820.99 g/mol |
| Exact Mass | 820.40 |
| IUPAC Name | buta-1,3-diene;(E)-3,4-dimethylpent-2-ene;[2-[2-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxyphenyl]phenyl] bis(2-propan-2-ylphenyl) phosphite |
| SMILES | C/C=C(\C)C(C)C.C=CC=C.CC(C)c1ccccc1OP(O)Oc1ccccc1-c1ccccc1OP(Oc1ccccc1C(C)C)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C39H42O6P2.C7H14.C4H6/c1-27(2)30-17-7-12-22-35(30)41-46(40)42-38-25-15-10-20-33(38)34-21-11-16-26-39(34)45-47(43-36-23-13-8-18-31(36)28(3)4)44-37-24-14-9-19-32(37)29(5)6;1-5-7(4)6(2)3;1-3-4-2/h7-29,40H,1-6H3;5-6H,1-4H3;3-4H,1-2H2/b;7-5+; |
| InChIKey | CJZCLOKBNMGWET-QVSSGMAGSA-N |
| XLogP | 16.13 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.99 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|