C41H42O7P2 — CID 142850207
[8-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxy-9-oxo-10H-anthracen-1-yl] bis(2-propan-2-ylphenyl) phosphite (PubChem CID 142850207) has the molecular formula C41H42O7P2 and a molecular weight of 708.73 g/mol. Its IUPAC name is [8-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxy-9-oxo-10H-anthracen-1-yl] bis(2-propan-2-ylphenyl) phosphite.
| Compound Name | [8-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxy-9-oxo-10H-anthracen-1-yl] bis(2-propan-2-ylphenyl) phosphite |
|---|---|
| PubChem CID | 142850207 |
| Molecular Formula | C41H42O7P2 |
| Molecular Weight | 708.73 g/mol |
| Exact Mass | 708.24 |
| IUPAC Name | [8-[hydroxy-(2-propan-2-ylphenoxy)phosphanyl]oxy-9-oxo-10H-anthracen-1-yl] bis(2-propan-2-ylphenyl) phosphite |
| SMILES | CC(C)c1ccccc1OP(O)Oc1cccc2c1C(=O)c1c(cccc1OP(Oc1ccccc1C(C)C)Oc1ccccc1C(C)C)C2 |
| InChI | InChI=1S/C41H42O7P2/c1-26(2)31-17-7-10-20-34(31)44-49(43)45-37-23-13-15-29-25-30-16-14-24-38(40(30)41(42)39(29)37)48-50(46-35-21-11-8-18-32(35)27(3)4)47-36-22-12-9-19-33(36)28(5)6/h7-24,26-28,43H,25H2,1-6H3 |
| InChIKey | ZQSMSMMJFXPWJM-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.73 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|