C32H28N2O8S2-2 — CID 22899498
3-[[9,10-dioxo-8-(2,4,6-trimethyl-3-oxidoperoxysulfanylanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonate (PubChem CID 22899498) has the molecular formula C32H28N2O8S2-2 and a molecular weight of 632.72 g/mol. Its IUPAC name is 3-[[9,10-dioxo-8-(2,4,6-trimethyl-3-oxidoperoxysulfanylanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonate.
| Compound Name | 3-[[9,10-dioxo-8-(2,4,6-trimethyl-3-oxidoperoxysulfanylanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 22899498 |
| Molecular Formula | C32H28N2O8S2-2 |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | 3-[[9,10-dioxo-8-(2,4,6-trimethyl-3-oxidoperoxysulfanylanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(SOO[O-])c(C)c1Nc1cccc2c1C(=O)c1c(Nc3c(C)cc(C)c(S(=O)(=O)[O-])c3C)cccc1C2=O |
| InChI | InChI=1S/C32H30N2O8S2/c1-15-13-17(3)31(43-42-41-37)19(5)27(15)33-23-11-7-9-21-25(23)30(36)26-22(29(21)35)10-8-12-24(26)34-28-16(2)14-18(4)32(20(28)6)44(38,39)40/h7-14,33-34,37H,1-6H3,(H,38,39,40)/p-2 |
| InChIKey | ZQNWAHGSZUGSRA-UHFFFAOYSA-L |
| XLogP | 5.93 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|