C8H9O3S- — CID 3015432
2,6-dimethylbenzenesulfonate (PubChem CID 3015432) has the molecular formula C8H9O3S- and a molecular weight of 185.22 g/mol. Its IUPAC name is 2,6-dimethylbenzenesulfonate.
| Compound Name | 2,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 3015432 |
| Molecular Formula | C8H9O3S- |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2,6-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(C)c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C8H10O3S/c1-6-4-3-5-7(2)8(6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11)/p-1 |
| InChIKey | BRETYAHLENMEAI-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|