C16H18O5S2 — CID 87941764
(2,6-dimethylphenyl)sulfonyl 2,6-dimethylbenzenesulfonate (PubChem CID 87941764) has the molecular formula C16H18O5S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2,6-dimethylphenyl)sulfonyl 2,6-dimethylbenzenesulfonate.
| Compound Name | (2,6-dimethylphenyl)sulfonyl 2,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87941764 |
| Molecular Formula | C16H18O5S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (2,6-dimethylphenyl)sulfonyl 2,6-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(C)c1S(=O)(=O)OS(=O)(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C16H18O5S2/c1-11-7-5-8-12(2)15(11)22(17,18)21-23(19,20)16-13(3)9-6-10-14(16)4/h5-10H,1-4H3 |
| InChIKey | KKULLDKZJJWAGD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |