C18H25O3PS — CID 139937907
[benzyl(trimethyl)-λ5-phosphanyl] 2,6-dimethylbenzenesulfonate (PubChem CID 139937907) has the molecular formula C18H25O3PS and a molecular weight of 352.44 g/mol. Its IUPAC name is [benzyl(trimethyl)-λ5-phosphanyl] 2,6-dimethylbenzenesulfonate.
| Compound Name | [benzyl(trimethyl)-λ5-phosphanyl] 2,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139937907 |
| Molecular Formula | C18H25O3PS |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [benzyl(trimethyl)-λ5-phosphanyl] 2,6-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(C)c1S(=O)(=O)OP(C)(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H25O3PS/c1-15-10-9-11-16(2)18(15)23(19,20)21-22(3,4,5)14-17-12-7-6-8-13-17/h6-13H,14H2,1-5H3 |
| InChIKey | JDNWGADCTCOKKR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|