C42H43O3PS — CID 139620794
(tetraphenyl-λ5-phosphanyl) 2,3-dibutylnaphthalene-1-sulfonate (PubChem CID 139620794) has the molecular formula C42H43O3PS and a molecular weight of 658.84 g/mol. Its IUPAC name is (tetraphenyl-λ5-phosphanyl) 2,3-dibutylnaphthalene-1-sulfonate.
| Compound Name | (tetraphenyl-λ5-phosphanyl) 2,3-dibutylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139620794 |
| Molecular Formula | C42H43O3PS |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | (tetraphenyl-λ5-phosphanyl) 2,3-dibutylnaphthalene-1-sulfonate |
| SMILES | CCCCc1cc2ccccc2c(S(=O)(=O)OP(c2ccccc2)(c2ccccc2)(c2ccccc2)c2ccccc2)c1CCCC |
| InChI | InChI=1S/C42H43O3PS/c1-3-5-21-34-33-35-22-19-20-32-41(35)42(40(34)31-6-4-2)47(43,44)45-46(36-23-11-7-12-24-36,37-25-13-8-14-26-37,38-27-15-9-16-28-38)39-29-17-10-18-30-39/h7-20,22-30,32-33H,3-6,21,31H2,1-2H3 |
| InChIKey | BWUGLUPDRKSAMC-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|