C36H63O3PS — CID 139620697
[tributyl(ethyl)-λ5-phosphanyl] 2,3-dihexylnaphthalene-1-sulfonate (PubChem CID 139620697) has the molecular formula C36H63O3PS and a molecular weight of 606.94 g/mol. Its IUPAC name is [tributyl(ethyl)-λ5-phosphanyl] 2,3-dihexylnaphthalene-1-sulfonate.
| Compound Name | [tributyl(ethyl)-λ5-phosphanyl] 2,3-dihexylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139620697 |
| Molecular Formula | C36H63O3PS |
| Molecular Weight | 606.94 g/mol |
| Exact Mass | 606.42 |
| IUPAC Name | [tributyl(ethyl)-λ5-phosphanyl] 2,3-dihexylnaphthalene-1-sulfonate |
| SMILES | CCCCCCc1cc2ccccc2c(S(=O)(=O)OP(CC)(CCCC)(CCCC)CCCC)c1CCCCCC |
| InChI | InChI=1S/C36H63O3PS/c1-7-13-18-20-24-32-31-33-25-22-23-27-35(33)36(34(32)26-21-19-14-8-2)41(37,38)39-40(12-6,28-15-9-3,29-16-10-4)30-17-11-5/h22-23,25,27,31H,7-21,24,26,28-30H2,1-6H3 |
| InChIKey | NXNKSUFLNQWZRM-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.94 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|