C56H103O3PS — CID 139620724
(tetrabutyl-λ5-phosphanyl) 2,3,4-tris-decylnaphthalene-1-sulfonate (PubChem CID 139620724) has the molecular formula C56H103O3PS and a molecular weight of 887.48 g/mol. Its IUPAC name is (tetrabutyl-λ5-phosphanyl) 2,3,4-tris-decylnaphthalene-1-sulfonate.
| Compound Name | (tetrabutyl-λ5-phosphanyl) 2,3,4-tris-decylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139620724 |
| Molecular Formula | C56H103O3PS |
| Molecular Weight | 887.48 g/mol |
| Exact Mass | 886.74 |
| IUPAC Name | (tetrabutyl-λ5-phosphanyl) 2,3,4-tris-decylnaphthalene-1-sulfonate |
| SMILES | CCCCCCCCCCc1c(CCCCCCCCCC)c(S(=O)(=O)OP(CCCC)(CCCC)(CCCC)CCCC)c2ccccc2c1CCCCCCCCCC |
| InChI | InChI=1S/C56H103O3PS/c1-8-15-22-25-28-31-34-37-42-51-52(43-38-35-32-29-26-23-16-9-2)54(45-39-36-33-30-27-24-17-10-3)56(55-46-41-40-44-53(51)55)61(57,58)59-60(47-18-11-4,48-19-12-5,49-20-13-6)50-21-14-7/h40-41,44,46H,8-39,42-43,45,47-50H2,1-7H3 |
| InChIKey | VTCKMEBSHJBBAM-UHFFFAOYSA-N |
| XLogP | 19.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.48 |
| LogP ≤ 5 | 19.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|