C28H45NO2S — CID 163976161
2,3-di(nonyl)naphthalene-1-sulfonamide (PubChem CID 163976161) has the molecular formula C28H45NO2S and a molecular weight of 459.74 g/mol. Its IUPAC name is 2,3-di(nonyl)naphthalene-1-sulfonamide.
| Compound Name | 2,3-di(nonyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 163976161 |
| Molecular Formula | C28H45NO2S |
| Molecular Weight | 459.74 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 2,3-di(nonyl)naphthalene-1-sulfonamide |
| SMILES | CCCCCCCCCc1cc2ccccc2c(S(N)(=O)=O)c1CCCCCCCCC |
| InChI | InChI=1S/C28H45NO2S/c1-3-5-7-9-11-13-15-19-24-23-25-20-17-18-22-27(25)28(32(29,30)31)26(24)21-16-14-12-10-8-6-4-2/h17-18,20,22-23H,3-16,19,21H2,1-2H3,(H2,29,30,31) |
| InChIKey | SUIMCVZAXKSAOT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.74 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|