About [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate
[methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate (PubChem CID 141245724) has the molecular formula C20H37O3PS
and a molecular weight of 388.55 g/mol. Its IUPAC name is [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate.
Molecular Properties
| Compound Name | [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate |
| PubChem CID | 141245724 |
| Molecular Formula | C20H37O3PS |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate |
| SMILES | CC(C)CP(C)(CC(C)C)(CC(C)C)OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H37O3PS/c1-17(2)13-24(7,14-18(3)4,15-19(5)6)23-25(21,22)16-20-11-9-8-10-12-20/h8-12,17-19H,13-16H2,1-7H3 |
| InChIKey | ZOSQNIJJGCYHQH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate?
The IUPAC name of [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate (CID 141245724) is [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate.
What is the SMILES notation for [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate?
The canonical SMILES for [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate is CC(C)CP(C)(CC(C)C)(CC(C)C)OS(=O)(=O)Cc1ccccc1.
What is the InChIKey of [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate?
The InChIKey is ZOSQNIJJGCYHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37O3PS/c1-17(2)13-24(7,14-18(3)4,15-19(5)6)23-25(21,22)16-20-11-9-8-10-12-20/h8-12,17-19H,13-16H2,1-7H3.
What are the key properties of [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate?
[methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate has a molecular weight of 388.55 g/mol, XLogP of 5.60, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-tris(2-methylpropyl)-λ5-phosphanyl] phenylmethanesulfonate is sourced from PubChem (CID 141245724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).