C20H34O3S — CID 141260248
[2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] phenylmethanesulfonate (PubChem CID 141260248) has the molecular formula C20H34O3S and a molecular weight of 354.56 g/mol. Its IUPAC name is [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] phenylmethanesulfonate.
| Compound Name | [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 141260248 |
| Molecular Formula | C20H34O3S |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [2,6-dimethyl-4-(2-methylpropyl)heptan-4-yl] phenylmethanesulfonate |
| SMILES | CC(C)CC(CC(C)C)(CC(C)C)OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H34O3S/c1-16(2)12-20(13-17(3)4,14-18(5)6)23-24(21,22)15-19-10-8-7-9-11-19/h7-11,16-18H,12-15H2,1-6H3 |
| InChIKey | JPKFEPTXEBAXEU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|