C6H3F2O3S- — CID 22057225
2,6-difluorobenzenesulfonate (PubChem CID 22057225) has the molecular formula C6H3F2O3S- and a molecular weight of 193.15 g/mol. Its IUPAC name is 2,6-difluorobenzenesulfonate.
| Compound Name | 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 22057225 |
| Molecular Formula | C6H3F2O3S- |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | 2,6-difluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)cccc1F |
| InChI | InChI=1S/C6H4F2O3S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H,(H,9,10,11)/p-1 |
| InChIKey | HHSDIWAVOYCKAW-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|