C6H4F5NO3S — CID 139512990
azanium 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 139512990) has the molecular formula C6H4F5NO3S and a molecular weight of 265.16 g/mol. Its IUPAC name is azanium 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | azanium 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 139512990 |
| Molecular Formula | C6H4F5NO3S |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | azanium 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.[NH4+] |
| InChI | InChI=1S/C6HF5O3S.H3N/c7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9;/h(H,12,13,14);1H3 |
| InChIKey | OZQXZBRUWLKDNM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|