C7F7KO3S — CID 101363595
potassium 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenesulfonate (PubChem CID 101363595) has the molecular formula C7F7KO3S and a molecular weight of 336.23 g/mol. Its IUPAC name is potassium 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenesulfonate.
| Compound Name | potassium 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 101363595 |
| Molecular Formula | C7F7KO3S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | potassium 2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(C(F)(F)F)c(F)c1F.[K+] |
| InChI | InChI=1S/C7HF7O3S.K/c8-2-1(7(12,13)14)3(9)5(11)6(4(2)10)18(15,16)17;/h(H,15,16,17);/q;+1/p-1 |
| InChIKey | BUURXAGPWUPCSH-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|